C28H20N2O6 — CID 2942949
(9,11,11-trimethyl-2,3-dioxo-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12),9-tetraen-6-yl) 2-(1,3-dioxobenzo[de]isoquinolin-2-yl)acetate (PubChem CID 2942949) has the molecular formula C28H20N2O6 and a molecular weight of 480.48 g/mol. Its IUPAC name is (9,11,11-trimethyl-2,3-dioxo-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12),9-tetraen-6-yl) 2-(1,3-dioxobenzo[de]isoquinolin-2-yl)acetate.
| Compound Name | (9,11,11-trimethyl-2,3-dioxo-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12),9-tetraen-6-yl) 2-(1,3-dioxobenzo[de]isoquinolin-2-yl)acetate |
|---|---|
| PubChem CID | 2942949 |
| Molecular Formula | C28H20N2O6 |
| Molecular Weight | 480.48 g/mol |
| Exact Mass | 480.13 |
| IUPAC Name | (9,11,11-trimethyl-2,3-dioxo-1-azatricyclo[6.3.1.04,12]dodeca-4,6,8(12),9-tetraen-6-yl) 2-(1,3-dioxobenzo[de]isoquinolin-2-yl)acetate |
| SMILES | CC1=CC(C)(C)N2C(=O)C(=O)c3cc(OC(=O)CN4C(=O)c5cccc6cccc(c56)C4=O)cc1c32 |
| InChI | InChI=1S/C28H20N2O6/c1-14-12-28(2,3)30-23-19(14)10-16(11-20(23)24(32)27(30)35)36-21(31)13-29-25(33)17-8-4-6-15-7-5-9-18(22(15)17)26(29)34/h4-12H,13H2,1-3H3 |
| InChIKey | ZUIXTIUWBWZISD-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.48 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|