C27H30N4O3 — CID 2943108
(4-ethylphenyl)-[4-[4-nitro-3-(1-phenylethylamino)phenyl]piperazin-1-yl]methanone (PubChem CID 2943108) has the molecular formula C27H30N4O3 and a molecular weight of 458.56 g/mol. Its IUPAC name is (4-ethylphenyl)-[4-[4-nitro-3-(1-phenylethylamino)phenyl]piperazin-1-yl]methanone.
| Compound Name | (4-ethylphenyl)-[4-[4-nitro-3-(1-phenylethylamino)phenyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 2943108 |
| Molecular Formula | C27H30N4O3 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | (4-ethylphenyl)-[4-[4-nitro-3-(1-phenylethylamino)phenyl]piperazin-1-yl]methanone |
| SMILES | CCc1ccc(C(=O)N2CCN(c3ccc([N+](=O)[O-])c(NC(C)c4ccccc4)c3)CC2)cc1 |
| InChI | InChI=1S/C27H30N4O3/c1-3-21-9-11-23(12-10-21)27(32)30-17-15-29(16-18-30)24-13-14-26(31(33)34)25(19-24)28-20(2)22-7-5-4-6-8-22/h4-14,19-20,28H,3,15-18H2,1-2H3 |
| InChIKey | IAXQFBRJWZHGQP-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 78.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|