C15H13N3O2S2 — CID 2943305
4-[(2-methyl-2,3-dihydroindol-1-yl)sulfonyl]-2,1,3-benzothiadiazole (PubChem CID 2943305) has the molecular formula C15H13N3O2S2 and a molecular weight of 331.42 g/mol. Its IUPAC name is 4-[(2-methyl-2,3-dihydroindol-1-yl)sulfonyl]-2,1,3-benzothiadiazole.
| Compound Name | 4-[(2-methyl-2,3-dihydroindol-1-yl)sulfonyl]-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 2943305 |
| Molecular Formula | C15H13N3O2S2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | 4-[(2-methyl-2,3-dihydroindol-1-yl)sulfonyl]-2,1,3-benzothiadiazole |
| SMILES | CC1Cc2ccccc2N1S(=O)(=O)c1cccc2nsnc12 |
| InChI | InChI=1S/C15H13N3O2S2/c1-10-9-11-5-2-3-7-13(11)18(10)22(19,20)14-8-4-6-12-15(14)17-21-16-12/h2-8,10H,9H2,1H3 |
| InChIKey | CVIUMGCPNZDTIU-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diazox_sulfon_A(36)', 'substructure': 'N/A'} |
|---|