C13H13NO2S2 — CID 2943362
2-methyl-1-thiophen-2-ylsulfonyl-2,3-dihydroindole (PubChem CID 2943362) has the molecular formula C13H13NO2S2 and a molecular weight of 279.39 g/mol. Its IUPAC name is 2-methyl-1-thiophen-2-ylsulfonyl-2,3-dihydroindole.
| Compound Name | 2-methyl-1-thiophen-2-ylsulfonyl-2,3-dihydroindole |
|---|---|
| PubChem CID | 2943362 |
| Molecular Formula | C13H13NO2S2 |
| Molecular Weight | 279.39 g/mol |
| Exact Mass | 279.04 |
| IUPAC Name | 2-methyl-1-thiophen-2-ylsulfonyl-2,3-dihydroindole |
| SMILES | CC1Cc2ccccc2N1S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C13H13NO2S2/c1-10-9-11-5-2-3-6-12(11)14(10)18(15,16)13-7-4-8-17-13/h2-8,10H,9H2,1H3 |
| InChIKey | BBLVFYLXLYPJLA-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.39 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |