C20H20N2O6 — CID 2943525
2,6-bis(oxolan-2-ylmethyl)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone (PubChem CID 2943525) has the molecular formula C20H20N2O6 and a molecular weight of 384.39 g/mol. Its IUPAC name is 2,6-bis(oxolan-2-ylmethyl)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone.
| Compound Name | 2,6-bis(oxolan-2-ylmethyl)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 2943525 |
| Molecular Formula | C20H20N2O6 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | 2,6-bis(oxolan-2-ylmethyl)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
| SMILES | O=c1c2cc3c(=O)n(CC4CCCO4)c(=O)c3cc2c(=O)n1CC1CCCO1 |
| InChI | InChI=1S/C20H20N2O6/c23-17-13-7-15-16(20(26)22(19(15)25)10-12-4-2-6-28-12)8-14(13)18(24)21(17)9-11-3-1-5-27-11/h7-8,11-12H,1-6,9-10H2 |
| InChIKey | KYCNNXOMFXBVGL-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 96.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |