About methyl 1-[1-(3,5-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]piperidine-4-carboxylate
methyl 1-[1-(3,5-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]piperidine-4-carboxylate (PubChem CID 2943725) has the molecular formula C19H24N2O4
and a molecular weight of 344.41 g/mol. Its IUPAC name is methyl 1-[1-(3,5-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]piperidine-4-carboxylate.
Molecular Properties
| Compound Name | methyl 1-[1-(3,5-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]piperidine-4-carboxylate |
| PubChem CID | 2943725 |
| Molecular Formula | C19H24N2O4 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | methyl 1-[1-(3,5-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(C2CC(=O)N(c3cc(C)cc(C)c3)C2=O)CC1 |
| InChI | InChI=1S/C19H24N2O4/c1-12-8-13(2)10-15(9-12)21-17(22)11-16(18(21)23)20-6-4-14(5-7-20)19(24)25-3/h8-10,14,16H,4-7,11H2,1-3H3 |
| InChIKey | LFTARHUMGDUOLR-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze methyl 1-[1-(3,5-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]piperidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-[1-(3,5-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]piperidine-4-carboxylate?
The IUPAC name of methyl 1-[1-(3,5-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]piperidine-4-carboxylate (CID 2943725) is methyl 1-[1-(3,5-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]piperidine-4-carboxylate.
What is the SMILES notation for methyl 1-[1-(3,5-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]piperidine-4-carboxylate?
The canonical SMILES for methyl 1-[1-(3,5-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]piperidine-4-carboxylate is COC(=O)C1CCN(C2CC(=O)N(c3cc(C)cc(C)c3)C2=O)CC1.
What is the InChIKey of methyl 1-[1-(3,5-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]piperidine-4-carboxylate?
The InChIKey is LFTARHUMGDUOLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24N2O4/c1-12-8-13(2)10-15(9-12)21-17(22)11-16(18(21)23)20-6-4-14(5-7-20)19(24)25-3/h8-10,14,16H,4-7,11H2,1-3H3.
What are the key properties of methyl 1-[1-(3,5-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]piperidine-4-carboxylate?
methyl 1-[1-(3,5-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]piperidine-4-carboxylate has a molecular weight of 344.41 g/mol, XLogP of 1.82, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-[1-(3,5-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]piperidine-4-carboxylate is sourced from PubChem (CID 2943725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).