C22H28N2O5 — CID 2943786
oxalic acid;1-[4-(4-phenylphenoxy)butyl]piperazine (PubChem CID 2943786) has the molecular formula C22H28N2O5 and a molecular weight of 400.48 g/mol. Its IUPAC name is oxalic acid;1-[4-(4-phenylphenoxy)butyl]piperazine.
| Compound Name | oxalic acid;1-[4-(4-phenylphenoxy)butyl]piperazine |
|---|---|
| PubChem CID | 2943786 |
| Molecular Formula | C22H28N2O5 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | oxalic acid;1-[4-(4-phenylphenoxy)butyl]piperazine |
| SMILES | O=C(O)C(=O)O.c1ccc(-c2ccc(OCCCCN3CCNCC3)cc2)cc1 |
| InChI | InChI=1S/C20H26N2O.C2H2O4/c1-2-6-18(7-3-1)19-8-10-20(11-9-19)23-17-5-4-14-22-15-12-21-13-16-22;3-1(4)2(5)6/h1-3,6-11,21H,4-5,12-17H2;(H,3,4)(H,5,6) |
| InChIKey | FODDTYNSQBVXKR-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|