C19H19FN4O5 — CID 2943819
N-(2-fluorophenyl)-2-[(2-morpholin-4-ylacetyl)amino]-5-nitrobenzamide (PubChem CID 2943819) has the molecular formula C19H19FN4O5 and a molecular weight of 402.38 g/mol. Its IUPAC name is N-(2-fluorophenyl)-2-[(2-morpholin-4-ylacetyl)amino]-5-nitrobenzamide.
| Compound Name | N-(2-fluorophenyl)-2-[(2-morpholin-4-ylacetyl)amino]-5-nitrobenzamide |
|---|---|
| PubChem CID | 2943819 |
| Molecular Formula | C19H19FN4O5 |
| Molecular Weight | 402.38 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | N-(2-fluorophenyl)-2-[(2-morpholin-4-ylacetyl)amino]-5-nitrobenzamide |
| SMILES | O=C(CN1CCOCC1)Nc1ccc([N+](=O)[O-])cc1C(=O)Nc1ccccc1F |
| InChI | InChI=1S/C19H19FN4O5/c20-15-3-1-2-4-17(15)22-19(26)14-11-13(24(27)28)5-6-16(14)21-18(25)12-23-7-9-29-10-8-23/h1-6,11H,7-10,12H2,(H,21,25)(H,22,26) |
| InChIKey | WEGIBENCHBHKKD-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.38 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|