About N-carbamoyl-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]acetamide
N-carbamoyl-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]acetamide (PubChem CID 29440114) has the molecular formula C10H15N5O2S
and a molecular weight of 269.33 g/mol. Its IUPAC name is N-carbamoyl-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]acetamide.
Molecular Properties
| Compound Name | N-carbamoyl-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]acetamide |
| PubChem CID | 29440114 |
| Molecular Formula | C10H15N5O2S |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | N-carbamoyl-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]acetamide |
| SMILES | NC(=O)NC(=O)CN1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C10H15N5O2S/c11-9(17)13-8(16)7-14-2-4-15(5-3-14)10-12-1-6-18-10/h1,6H,2-5,7H2,(H3,11,13,16,17) |
| InChIKey | BSDYJWDUTITDFX-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-carbamoyl-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-carbamoyl-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]acetamide?
The IUPAC name of N-carbamoyl-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]acetamide (CID 29440114) is N-carbamoyl-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]acetamide.
What is the SMILES notation for N-carbamoyl-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]acetamide?
The canonical SMILES for N-carbamoyl-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]acetamide is NC(=O)NC(=O)CN1CCN(c2nccs2)CC1.
What is the InChIKey of N-carbamoyl-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]acetamide?
The InChIKey is BSDYJWDUTITDFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N5O2S/c11-9(17)13-8(16)7-14-2-4-15(5-3-14)10-12-1-6-18-10/h1,6H,2-5,7H2,(H3,11,13,16,17).
What are the key properties of N-carbamoyl-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]acetamide?
N-carbamoyl-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]acetamide has a molecular weight of 269.33 g/mol, XLogP of -0.54, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-carbamoyl-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]acetamide is sourced from PubChem (CID 29440114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).