C18H27N3O3 — CID 2944026
2-(4-nitrophenyl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)propanamide (PubChem CID 2944026) has the molecular formula C18H27N3O3 and a molecular weight of 333.43 g/mol. Its IUPAC name is 2-(4-nitrophenyl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)propanamide.
| Compound Name | 2-(4-nitrophenyl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)propanamide |
|---|---|
| PubChem CID | 2944026 |
| Molecular Formula | C18H27N3O3 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | 2-(4-nitrophenyl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)propanamide |
| SMILES | CC(C(=O)NC1CC(C)(C)NC(C)(C)C1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H27N3O3/c1-12(13-6-8-15(9-7-13)21(23)24)16(22)19-14-10-17(2,3)20-18(4,5)11-14/h6-9,12,14,20H,10-11H2,1-5H3,(H,19,22) |
| InChIKey | YZJUUVOUHDUHMZ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|