C19H23N5O2S2 — CID 29447570
N-(5-butyl-1,3,4-thiadiazol-2-yl)-4-methyl-2-oxo-6-thia-1,8-diazatricyclo[7.5.0.03,7]tetradeca-3(7),4,8-triene-5-carboxamide (PubChem CID 29447570) has the molecular formula C19H23N5O2S2 and a molecular weight of 417.56 g/mol. Its IUPAC name is N-(5-butyl-1,3,4-thiadiazol-2-yl)-4-methyl-2-oxo-6-thia-1,8-diazatricyclo[7.5.0.03,7]tetradeca-3(7),4,8-triene-5-carboxamide.
| Compound Name | N-(5-butyl-1,3,4-thiadiazol-2-yl)-4-methyl-2-oxo-6-thia-1,8-diazatricyclo[7.5.0.03,7]tetradeca-3(7),4,8-triene-5-carboxamide |
|---|---|
| PubChem CID | 29447570 |
| Molecular Formula | C19H23N5O2S2 |
| Molecular Weight | 417.56 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | N-(5-butyl-1,3,4-thiadiazol-2-yl)-4-methyl-2-oxo-6-thia-1,8-diazatricyclo[7.5.0.03,7]tetradeca-3(7),4,8-triene-5-carboxamide |
| SMILES | CCCCc1nnc(NC(=O)c2sc3nc4n(c(=O)c3c2C)CCCCC4)s1 |
| InChI | InChI=1S/C19H23N5O2S2/c1-3-4-9-13-22-23-19(27-13)21-16(25)15-11(2)14-17(28-15)20-12-8-6-5-7-10-24(12)18(14)26/h3-10H2,1-2H3,(H,21,23,25) |
| InChIKey | VPRGHXWLUNMPCF-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.56 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |