About 2-(4-chlorophenyl)-4,5-dihydro-1H-imidazole;hydrochloride
2-(4-chlorophenyl)-4,5-dihydro-1H-imidazole;hydrochloride (PubChem CID 2945131) has the molecular formula C9H10Cl2N2
and a molecular weight of 217.10 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-4,5-dihydro-1H-imidazole;hydrochloride.
Molecular Properties
| Compound Name | 2-(4-chlorophenyl)-4,5-dihydro-1H-imidazole;hydrochloride |
| PubChem CID | 2945131 |
| Molecular Formula | C9H10Cl2N2 |
| Molecular Weight | 217.10 g/mol |
| Exact Mass | 216.02 |
| IUPAC Name | 2-(4-chlorophenyl)-4,5-dihydro-1H-imidazole;hydrochloride |
| SMILES | Cl.Clc1ccc(C2=NCCN2)cc1 |
| InChI | InChI=1S/C9H9ClN2.ClH/c10-8-3-1-7(2-4-8)9-11-5-6-12-9;/h1-4H,5-6H2,(H,11,12);1H |
| InChIKey | ZIVFWDYGKDABDC-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.10 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4-chlorophenyl)-4,5-dihydro-1H-imidazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chlorophenyl)-4,5-dihydro-1H-imidazole;hydrochloride?
The IUPAC name of 2-(4-chlorophenyl)-4,5-dihydro-1H-imidazole;hydrochloride (CID 2945131) is 2-(4-chlorophenyl)-4,5-dihydro-1H-imidazole;hydrochloride.
What is the SMILES notation for 2-(4-chlorophenyl)-4,5-dihydro-1H-imidazole;hydrochloride?
The canonical SMILES for 2-(4-chlorophenyl)-4,5-dihydro-1H-imidazole;hydrochloride is Cl.Clc1ccc(C2=NCCN2)cc1.
What is the InChIKey of 2-(4-chlorophenyl)-4,5-dihydro-1H-imidazole;hydrochloride?
The InChIKey is ZIVFWDYGKDABDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9ClN2.ClH/c10-8-3-1-7(2-4-8)9-11-5-6-12-9;/h1-4H,5-6H2,(H,11,12);1H.
What are the key properties of 2-(4-chlorophenyl)-4,5-dihydro-1H-imidazole;hydrochloride?
2-(4-chlorophenyl)-4,5-dihydro-1H-imidazole;hydrochloride has a molecular weight of 217.10 g/mol, XLogP of 2.11, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chlorophenyl)-4,5-dihydro-1H-imidazole;hydrochloride is sourced from PubChem (CID 2945131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).