About N-[(3,4-dimethoxyphenyl)methyl]-N-[3-(4-methoxyphenyl)-3-phenylpropyl]acetamide
N-[(3,4-dimethoxyphenyl)methyl]-N-[3-(4-methoxyphenyl)-3-phenylpropyl]acetamide (PubChem CID 2945141) has the molecular formula C27H31NO4
and a molecular weight of 433.55 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]-N-[3-(4-methoxyphenyl)-3-phenylpropyl]acetamide.
Molecular Properties
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]-N-[3-(4-methoxyphenyl)-3-phenylpropyl]acetamide |
| PubChem CID | 2945141 |
| Molecular Formula | C27H31NO4 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]-N-[3-(4-methoxyphenyl)-3-phenylpropyl]acetamide |
| SMILES | COc1ccc(C(CCN(Cc2ccc(OC)c(OC)c2)C(C)=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H31NO4/c1-20(29)28(19-21-10-15-26(31-3)27(18-21)32-4)17-16-25(22-8-6-5-7-9-22)23-11-13-24(30-2)14-12-23/h5-15,18,25H,16-17,19H2,1-4H3 |
| InChIKey | FIAIWQVEJJZKHG-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(3,4-dimethoxyphenyl)methyl]-N-[3-(4-methoxyphenyl)-3-phenylpropyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3,4-dimethoxyphenyl)methyl]-N-[3-(4-methoxyphenyl)-3-phenylpropyl]acetamide?
The IUPAC name of N-[(3,4-dimethoxyphenyl)methyl]-N-[3-(4-methoxyphenyl)-3-phenylpropyl]acetamide (CID 2945141) is N-[(3,4-dimethoxyphenyl)methyl]-N-[3-(4-methoxyphenyl)-3-phenylpropyl]acetamide.
What is the SMILES notation for N-[(3,4-dimethoxyphenyl)methyl]-N-[3-(4-methoxyphenyl)-3-phenylpropyl]acetamide?
The canonical SMILES for N-[(3,4-dimethoxyphenyl)methyl]-N-[3-(4-methoxyphenyl)-3-phenylpropyl]acetamide is COc1ccc(C(CCN(Cc2ccc(OC)c(OC)c2)C(C)=O)c2ccccc2)cc1.
What is the InChIKey of N-[(3,4-dimethoxyphenyl)methyl]-N-[3-(4-methoxyphenyl)-3-phenylpropyl]acetamide?
The InChIKey is FIAIWQVEJJZKHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H31NO4/c1-20(29)28(19-21-10-15-26(31-3)27(18-21)32-4)17-16-25(22-8-6-5-7-9-22)23-11-13-24(30-2)14-12-23/h5-15,18,25H,16-17,19H2,1-4H3.
What are the key properties of N-[(3,4-dimethoxyphenyl)methyl]-N-[3-(4-methoxyphenyl)-3-phenylpropyl]acetamide?
N-[(3,4-dimethoxyphenyl)methyl]-N-[3-(4-methoxyphenyl)-3-phenylpropyl]acetamide has a molecular weight of 433.55 g/mol, XLogP of 5.28, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3,4-dimethoxyphenyl)methyl]-N-[3-(4-methoxyphenyl)-3-phenylpropyl]acetamide is sourced from PubChem (CID 2945141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).