About 4-chloro-N'-cyclohexylbenzenecarboximidamide;hydrochloride
4-chloro-N'-cyclohexylbenzenecarboximidamide;hydrochloride (PubChem CID 2945295) has the molecular formula C13H18Cl2N2
and a molecular weight of 273.21 g/mol. Its IUPAC name is 4-chloro-N'-cyclohexylbenzenecarboximidamide;hydrochloride.
Molecular Properties
| Compound Name | 4-chloro-N'-cyclohexylbenzenecarboximidamide;hydrochloride |
| PubChem CID | 2945295 |
| Molecular Formula | C13H18Cl2N2 |
| Molecular Weight | 273.21 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 4-chloro-N'-cyclohexylbenzenecarboximidamide;hydrochloride |
| SMILES | Cl.N/C(=N\C1CCCCC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H17ClN2.ClH/c14-11-8-6-10(7-9-11)13(15)16-12-4-2-1-3-5-12;/h6-9,12H,1-5H2,(H2,15,16);1H |
| InChIKey | WJSHVTZTXIWURX-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.21 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-N'-cyclohexylbenzenecarboximidamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N'-cyclohexylbenzenecarboximidamide;hydrochloride?
The IUPAC name of 4-chloro-N'-cyclohexylbenzenecarboximidamide;hydrochloride (CID 2945295) is 4-chloro-N'-cyclohexylbenzenecarboximidamide;hydrochloride.
What is the SMILES notation for 4-chloro-N'-cyclohexylbenzenecarboximidamide;hydrochloride?
The canonical SMILES for 4-chloro-N'-cyclohexylbenzenecarboximidamide;hydrochloride is Cl.N/C(=N\C1CCCCC1)c1ccc(Cl)cc1.
What is the InChIKey of 4-chloro-N'-cyclohexylbenzenecarboximidamide;hydrochloride?
The InChIKey is WJSHVTZTXIWURX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17ClN2.ClH/c14-11-8-6-10(7-9-11)13(15)16-12-4-2-1-3-5-12;/h6-9,12H,1-5H2,(H2,15,16);1H.
What are the key properties of 4-chloro-N'-cyclohexylbenzenecarboximidamide;hydrochloride?
4-chloro-N'-cyclohexylbenzenecarboximidamide;hydrochloride has a molecular weight of 273.21 g/mol, XLogP of 3.80, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N'-cyclohexylbenzenecarboximidamide;hydrochloride is sourced from PubChem (CID 2945295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).