About N-(2,5-difluorophenyl)-2-(2-methyl-1,3-thiazol-4-yl)acetamide
N-(2,5-difluorophenyl)-2-(2-methyl-1,3-thiazol-4-yl)acetamide (PubChem CID 29453921) has the molecular formula C12H10F2N2OS
and a molecular weight of 268.29 g/mol. Its IUPAC name is N-(2,5-difluorophenyl)-2-(2-methyl-1,3-thiazol-4-yl)acetamide.
Molecular Properties
| Compound Name | N-(2,5-difluorophenyl)-2-(2-methyl-1,3-thiazol-4-yl)acetamide |
| PubChem CID | 29453921 |
| Molecular Formula | C12H10F2N2OS |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | N-(2,5-difluorophenyl)-2-(2-methyl-1,3-thiazol-4-yl)acetamide |
| SMILES | Cc1nc(CC(=O)Nc2cc(F)ccc2F)cs1 |
| InChI | InChI=1S/C12H10F2N2OS/c1-7-15-9(6-18-7)5-12(17)16-11-4-8(13)2-3-10(11)14/h2-4,6H,5H2,1H3,(H,16,17) |
| InChIKey | DTEPGWZPXVGDJF-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2,5-difluorophenyl)-2-(2-methyl-1,3-thiazol-4-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,5-difluorophenyl)-2-(2-methyl-1,3-thiazol-4-yl)acetamide?
The IUPAC name of N-(2,5-difluorophenyl)-2-(2-methyl-1,3-thiazol-4-yl)acetamide (CID 29453921) is N-(2,5-difluorophenyl)-2-(2-methyl-1,3-thiazol-4-yl)acetamide.
What is the SMILES notation for N-(2,5-difluorophenyl)-2-(2-methyl-1,3-thiazol-4-yl)acetamide?
The canonical SMILES for N-(2,5-difluorophenyl)-2-(2-methyl-1,3-thiazol-4-yl)acetamide is Cc1nc(CC(=O)Nc2cc(F)ccc2F)cs1.
What is the InChIKey of N-(2,5-difluorophenyl)-2-(2-methyl-1,3-thiazol-4-yl)acetamide?
The InChIKey is DTEPGWZPXVGDJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10F2N2OS/c1-7-15-9(6-18-7)5-12(17)16-11-4-8(13)2-3-10(11)14/h2-4,6H,5H2,1H3,(H,16,17).
What are the key properties of N-(2,5-difluorophenyl)-2-(2-methyl-1,3-thiazol-4-yl)acetamide?
N-(2,5-difluorophenyl)-2-(2-methyl-1,3-thiazol-4-yl)acetamide has a molecular weight of 268.29 g/mol, XLogP of 2.91, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,5-difluorophenyl)-2-(2-methyl-1,3-thiazol-4-yl)acetamide is sourced from PubChem (CID 29453921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).