C19H21NO4 — CID 2945629
6-(1-acetylindol-3-yl)-3,3,5,5-tetramethyloxane-2,4-dione (PubChem CID 2945629) has the molecular formula C19H21NO4 and a molecular weight of 327.38 g/mol. Its IUPAC name is 6-(1-acetylindol-3-yl)-3,3,5,5-tetramethyloxane-2,4-dione.
| Compound Name | 6-(1-acetylindol-3-yl)-3,3,5,5-tetramethyloxane-2,4-dione |
|---|---|
| PubChem CID | 2945629 |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | 6-(1-acetylindol-3-yl)-3,3,5,5-tetramethyloxane-2,4-dione |
| SMILES | CC(=O)n1cc(C2OC(=O)C(C)(C)C(=O)C2(C)C)c2ccccc21 |
| InChI | InChI=1S/C19H21NO4/c1-11(21)20-10-13(12-8-6-7-9-14(12)20)15-18(2,3)16(22)19(4,5)17(23)24-15/h6-10,15H,1-5H3 |
| InChIKey | QXWQUHBXWVNFMX-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 65.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|