About 4-[[2-(1,3-benzodioxol-5-yl)ethylamino]methyl]-2-methoxyphenol;hydrochloride
4-[[2-(1,3-benzodioxol-5-yl)ethylamino]methyl]-2-methoxyphenol;hydrochloride (PubChem CID 2945729) has the molecular formula C17H20ClNO4
and a molecular weight of 337.80 g/mol. Its IUPAC name is 4-[[2-(1,3-benzodioxol-5-yl)ethylamino]methyl]-2-methoxyphenol;hydrochloride.
Molecular Properties
| Compound Name | 4-[[2-(1,3-benzodioxol-5-yl)ethylamino]methyl]-2-methoxyphenol;hydrochloride |
| PubChem CID | 2945729 |
| Molecular Formula | C17H20ClNO4 |
| Molecular Weight | 337.80 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | 4-[[2-(1,3-benzodioxol-5-yl)ethylamino]methyl]-2-methoxyphenol;hydrochloride |
| SMILES | COc1cc(CNCCc2ccc3c(c2)OCO3)ccc1O.Cl |
| InChI | InChI=1S/C17H19NO4.ClH/c1-20-16-9-13(2-4-14(16)19)10-18-7-6-12-3-5-15-17(8-12)22-11-21-15;/h2-5,8-9,18-19H,6-7,10-11H2,1H3;1H |
| InChIKey | VZXVFELAYZQZCO-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.80 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[[2-(1,3-benzodioxol-5-yl)ethylamino]methyl]-2-methoxyphenol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[2-(1,3-benzodioxol-5-yl)ethylamino]methyl]-2-methoxyphenol;hydrochloride?
The IUPAC name of 4-[[2-(1,3-benzodioxol-5-yl)ethylamino]methyl]-2-methoxyphenol;hydrochloride (CID 2945729) is 4-[[2-(1,3-benzodioxol-5-yl)ethylamino]methyl]-2-methoxyphenol;hydrochloride.
What is the SMILES notation for 4-[[2-(1,3-benzodioxol-5-yl)ethylamino]methyl]-2-methoxyphenol;hydrochloride?
The canonical SMILES for 4-[[2-(1,3-benzodioxol-5-yl)ethylamino]methyl]-2-methoxyphenol;hydrochloride is COc1cc(CNCCc2ccc3c(c2)OCO3)ccc1O.Cl.
What is the InChIKey of 4-[[2-(1,3-benzodioxol-5-yl)ethylamino]methyl]-2-methoxyphenol;hydrochloride?
The InChIKey is VZXVFELAYZQZCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO4.ClH/c1-20-16-9-13(2-4-14(16)19)10-18-7-6-12-3-5-15-17(8-12)22-11-21-15;/h2-5,8-9,18-19H,6-7,10-11H2,1H3;1H.
What are the key properties of 4-[[2-(1,3-benzodioxol-5-yl)ethylamino]methyl]-2-methoxyphenol;hydrochloride?
4-[[2-(1,3-benzodioxol-5-yl)ethylamino]methyl]-2-methoxyphenol;hydrochloride has a molecular weight of 337.80 g/mol, XLogP of 2.88, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[2-(1,3-benzodioxol-5-yl)ethylamino]methyl]-2-methoxyphenol;hydrochloride is sourced from PubChem (CID 2945729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).