C17H14FN3O2S — CID 2945768
5-(3-fluorophenyl)-2-sulfanylidene-1,5,7,8,9,10-hexahydropyrimido[4,5-b]quinoline-4,6-dione (PubChem CID 2945768) has the molecular formula C17H14FN3O2S and a molecular weight of 343.38 g/mol. Its IUPAC name is 5-(3-fluorophenyl)-2-sulfanylidene-1,5,7,8,9,10-hexahydropyrimido[4,5-b]quinoline-4,6-dione.
| Compound Name | 5-(3-fluorophenyl)-2-sulfanylidene-1,5,7,8,9,10-hexahydropyrimido[4,5-b]quinoline-4,6-dione |
|---|---|
| PubChem CID | 2945768 |
| Molecular Formula | C17H14FN3O2S |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | 5-(3-fluorophenyl)-2-sulfanylidene-1,5,7,8,9,10-hexahydropyrimido[4,5-b]quinoline-4,6-dione |
| SMILES | O=C1CCCC2=C1C(c1cccc(F)c1)c1c([nH]c(=S)[nH]c1=O)N2 |
| InChI | InChI=1S/C17H14FN3O2S/c18-9-4-1-3-8(7-9)12-13-10(5-2-6-11(13)22)19-15-14(12)16(23)21-17(24)20-15/h1,3-4,7,12H,2,5-6H2,(H3,19,20,21,23,24) |
| InChIKey | SYDKXZKEYXLAOO-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|