C20H22N4O3S3 — CID 29458876
2-[[2-(3,5,6-trimethyl-4-oxothieno[2,3-d]pyrimidin-2-yl)sulfanylacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 29458876) has the molecular formula C20H22N4O3S3 and a molecular weight of 462.62 g/mol. Its IUPAC name is 2-[[2-(3,5,6-trimethyl-4-oxothieno[2,3-d]pyrimidin-2-yl)sulfanylacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-[[2-(3,5,6-trimethyl-4-oxothieno[2,3-d]pyrimidin-2-yl)sulfanylacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 29458876 |
| Molecular Formula | C20H22N4O3S3 |
| Molecular Weight | 462.62 g/mol |
| Exact Mass | 462.09 |
| IUPAC Name | 2-[[2-(3,5,6-trimethyl-4-oxothieno[2,3-d]pyrimidin-2-yl)sulfanylacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | Cc1sc2nc(SCC(=O)Nc3sc4c(c3C(N)=O)CCCC4)n(C)c(=O)c2c1C |
| InChI | InChI=1S/C20H22N4O3S3/c1-9-10(2)29-17-14(9)19(27)24(3)20(23-17)28-8-13(25)22-18-15(16(21)26)11-6-4-5-7-12(11)30-18/h4-8H2,1-3H3,(H2,21,26)(H,22,25) |
| InChIKey | ZWVLZQBDXGBUTG-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.62 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |