C27H22N4O3S — CID 29462838
(2R)-2-[[4-(2,4-dimethylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(9,10-dioxoanthracen-2-yl)propanamide (PubChem CID 29462838) has the molecular formula C27H22N4O3S and a molecular weight of 482.57 g/mol. Its IUPAC name is (2R)-2-[[4-(2,4-dimethylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(9,10-dioxoanthracen-2-yl)propanamide.
| Compound Name | (2R)-2-[[4-(2,4-dimethylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(9,10-dioxoanthracen-2-yl)propanamide |
|---|---|
| PubChem CID | 29462838 |
| Molecular Formula | C27H22N4O3S |
| Molecular Weight | 482.57 g/mol |
| Exact Mass | 482.14 |
| IUPAC Name | (2R)-2-[[4-(2,4-dimethylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(9,10-dioxoanthracen-2-yl)propanamide |
| SMILES | Cc1ccc(-n2cnnc2S[C@H](C)C(=O)Nc2ccc3c(c2)C(=O)c2ccccc2C3=O)c(C)c1 |
| InChI | InChI=1S/C27H22N4O3S/c1-15-8-11-23(16(2)12-15)31-14-28-30-27(31)35-17(3)26(34)29-18-9-10-21-22(13-18)25(33)20-7-5-4-6-19(20)24(21)32/h4-14,17H,1-3H3,(H,29,34)/t17-/m1/s1 |
| InChIKey | XJEXBMHGIYXCMV-QGZVFWFLSA-N |
| XLogP | 4.78 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.57 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|