About 2-(2,6-dimethylmorpholin-4-yl)-N-(4-sulfamoylphenyl)acetamide
2-(2,6-dimethylmorpholin-4-yl)-N-(4-sulfamoylphenyl)acetamide (PubChem CID 2946285) has the molecular formula C14H21N3O4S
and a molecular weight of 327.41 g/mol. Its IUPAC name is 2-(2,6-dimethylmorpholin-4-yl)-N-(4-sulfamoylphenyl)acetamide.
Molecular Properties
| Compound Name | 2-(2,6-dimethylmorpholin-4-yl)-N-(4-sulfamoylphenyl)acetamide |
| PubChem CID | 2946285 |
| Molecular Formula | C14H21N3O4S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 2-(2,6-dimethylmorpholin-4-yl)-N-(4-sulfamoylphenyl)acetamide |
| SMILES | CC1CN(CC(=O)Nc2ccc(S(N)(=O)=O)cc2)CC(C)O1 |
| InChI | InChI=1S/C14H21N3O4S/c1-10-7-17(8-11(2)21-10)9-14(18)16-12-3-5-13(6-4-12)22(15,19)20/h3-6,10-11H,7-9H2,1-2H3,(H,16,18)(H2,15,19,20) |
| InChIKey | MQMYZRLXKPVHKY-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(2,6-dimethylmorpholin-4-yl)-N-(4-sulfamoylphenyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,6-dimethylmorpholin-4-yl)-N-(4-sulfamoylphenyl)acetamide?
The IUPAC name of 2-(2,6-dimethylmorpholin-4-yl)-N-(4-sulfamoylphenyl)acetamide (CID 2946285) is 2-(2,6-dimethylmorpholin-4-yl)-N-(4-sulfamoylphenyl)acetamide.
What is the SMILES notation for 2-(2,6-dimethylmorpholin-4-yl)-N-(4-sulfamoylphenyl)acetamide?
The canonical SMILES for 2-(2,6-dimethylmorpholin-4-yl)-N-(4-sulfamoylphenyl)acetamide is CC1CN(CC(=O)Nc2ccc(S(N)(=O)=O)cc2)CC(C)O1.
What is the InChIKey of 2-(2,6-dimethylmorpholin-4-yl)-N-(4-sulfamoylphenyl)acetamide?
The InChIKey is MQMYZRLXKPVHKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N3O4S/c1-10-7-17(8-11(2)21-10)9-14(18)16-12-3-5-13(6-4-12)22(15,19)20/h3-6,10-11H,7-9H2,1-2H3,(H,16,18)(H2,15,19,20).
What are the key properties of 2-(2,6-dimethylmorpholin-4-yl)-N-(4-sulfamoylphenyl)acetamide?
2-(2,6-dimethylmorpholin-4-yl)-N-(4-sulfamoylphenyl)acetamide has a molecular weight of 327.41 g/mol, XLogP of 0.38, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,6-dimethylmorpholin-4-yl)-N-(4-sulfamoylphenyl)acetamide is sourced from PubChem (CID 2946285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).