About 3-(6,6-dimethyl-4-oxooxan-2-yl)-3-hydroxy-1-propylindol-2-one
3-(6,6-dimethyl-4-oxooxan-2-yl)-3-hydroxy-1-propylindol-2-one (PubChem CID 2946339) has the molecular formula C18H23NO4
and a molecular weight of 317.38 g/mol. Its IUPAC name is 3-(6,6-dimethyl-4-oxooxan-2-yl)-3-hydroxy-1-propylindol-2-one.
Molecular Properties
| Compound Name | 3-(6,6-dimethyl-4-oxooxan-2-yl)-3-hydroxy-1-propylindol-2-one |
| PubChem CID | 2946339 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 3-(6,6-dimethyl-4-oxooxan-2-yl)-3-hydroxy-1-propylindol-2-one |
| SMILES | CCCN1C(=O)C(O)(C2CC(=O)CC(C)(C)O2)c2ccccc21 |
| InChI | InChI=1S/C18H23NO4/c1-4-9-19-14-8-6-5-7-13(14)18(22,16(19)21)15-10-12(20)11-17(2,3)23-15/h5-8,15,22H,4,9-11H2,1-3H3 |
| InChIKey | WNOOZNWADQQYDA-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(6,6-dimethyl-4-oxooxan-2-yl)-3-hydroxy-1-propylindol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(6,6-dimethyl-4-oxooxan-2-yl)-3-hydroxy-1-propylindol-2-one?
The IUPAC name of 3-(6,6-dimethyl-4-oxooxan-2-yl)-3-hydroxy-1-propylindol-2-one (CID 2946339) is 3-(6,6-dimethyl-4-oxooxan-2-yl)-3-hydroxy-1-propylindol-2-one.
What is the SMILES notation for 3-(6,6-dimethyl-4-oxooxan-2-yl)-3-hydroxy-1-propylindol-2-one?
The canonical SMILES for 3-(6,6-dimethyl-4-oxooxan-2-yl)-3-hydroxy-1-propylindol-2-one is CCCN1C(=O)C(O)(C2CC(=O)CC(C)(C)O2)c2ccccc21.
What is the InChIKey of 3-(6,6-dimethyl-4-oxooxan-2-yl)-3-hydroxy-1-propylindol-2-one?
The InChIKey is WNOOZNWADQQYDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23NO4/c1-4-9-19-14-8-6-5-7-13(14)18(22,16(19)21)15-10-12(20)11-17(2,3)23-15/h5-8,15,22H,4,9-11H2,1-3H3.
What are the key properties of 3-(6,6-dimethyl-4-oxooxan-2-yl)-3-hydroxy-1-propylindol-2-one?
3-(6,6-dimethyl-4-oxooxan-2-yl)-3-hydroxy-1-propylindol-2-one has a molecular weight of 317.38 g/mol, XLogP of 2.16, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(6,6-dimethyl-4-oxooxan-2-yl)-3-hydroxy-1-propylindol-2-one is sourced from PubChem (CID 2946339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).