C17H22N6O2S — CID 2946449
2-[[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]sulfanyl]-3-oxo-N-phenylbutanamide (PubChem CID 2946449) has the molecular formula C17H22N6O2S and a molecular weight of 374.47 g/mol. Its IUPAC name is 2-[[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]sulfanyl]-3-oxo-N-phenylbutanamide.
| Compound Name | 2-[[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]sulfanyl]-3-oxo-N-phenylbutanamide |
|---|---|
| PubChem CID | 2946449 |
| Molecular Formula | C17H22N6O2S |
| Molecular Weight | 374.47 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 2-[[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]sulfanyl]-3-oxo-N-phenylbutanamide |
| SMILES | CC(=O)C(Sc1nc(N(C)C)nc(N(C)C)n1)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C17H22N6O2S/c1-11(24)13(14(25)18-12-9-7-6-8-10-12)26-17-20-15(22(2)3)19-16(21-17)23(4)5/h6-10,13H,1-5H3,(H,18,25) |
| InChIKey | NAUWWZPQVAVOBW-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.47 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|