C16H21NO3 — CID 2946900
5,5-diethyl-3,3-dimethyl-6-pyridin-2-yloxane-2,4-dione (PubChem CID 2946900) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is 5,5-diethyl-3,3-dimethyl-6-pyridin-2-yloxane-2,4-dione.
| Compound Name | 5,5-diethyl-3,3-dimethyl-6-pyridin-2-yloxane-2,4-dione |
|---|---|
| PubChem CID | 2946900 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 5,5-diethyl-3,3-dimethyl-6-pyridin-2-yloxane-2,4-dione |
| SMILES | CCC1(CC)C(=O)C(C)(C)C(=O)OC1c1ccccn1 |
| InChI | InChI=1S/C16H21NO3/c1-5-16(6-2)12(11-9-7-8-10-17-11)20-14(19)15(3,4)13(16)18/h7-10,12H,5-6H2,1-4H3 |
| InChIKey | LRPHGLCFXAYNKR-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|