C16H15F2NOS — CID 2947131
N-(2,4-difluorophenyl)-2-(4-methylphenyl)sulfanylpropanamide (PubChem CID 2947131) has the molecular formula C16H15F2NOS and a molecular weight of 307.37 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-2-(4-methylphenyl)sulfanylpropanamide.
| Compound Name | N-(2,4-difluorophenyl)-2-(4-methylphenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 2947131 |
| Molecular Formula | C16H15F2NOS |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | N-(2,4-difluorophenyl)-2-(4-methylphenyl)sulfanylpropanamide |
| SMILES | Cc1ccc(SC(C)C(=O)Nc2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C16H15F2NOS/c1-10-3-6-13(7-4-10)21-11(2)16(20)19-15-8-5-12(17)9-14(15)18/h3-9,11H,1-2H3,(H,19,20) |
| InChIKey | GNPIYCYUYIJGOU-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |