C27H27N3O5 — CID 2947200
5-[(2,4-dimethoxyphenyl)methyl]-1-(3-methylphenyl)-5-(2-pyridin-4-ylethyl)-1,3-diazinane-2,4,6-trione (PubChem CID 2947200) has the molecular formula C27H27N3O5 and a molecular weight of 473.53 g/mol. Its IUPAC name is 5-[(2,4-dimethoxyphenyl)methyl]-1-(3-methylphenyl)-5-(2-pyridin-4-ylethyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[(2,4-dimethoxyphenyl)methyl]-1-(3-methylphenyl)-5-(2-pyridin-4-ylethyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 2947200 |
| Molecular Formula | C27H27N3O5 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | 5-[(2,4-dimethoxyphenyl)methyl]-1-(3-methylphenyl)-5-(2-pyridin-4-ylethyl)-1,3-diazinane-2,4,6-trione |
| SMILES | COc1ccc(CC2(CCc3ccncc3)C(=O)NC(=O)N(c3cccc(C)c3)C2=O)c(OC)c1 |
| InChI | InChI=1S/C27H27N3O5/c1-18-5-4-6-21(15-18)30-25(32)27(24(31)29-26(30)33,12-9-19-10-13-28-14-11-19)17-20-7-8-22(34-2)16-23(20)35-3/h4-8,10-11,13-16H,9,12,17H2,1-3H3,(H,29,31,33) |
| InChIKey | CTRWHOLXILNZCG-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|