About 3,4,5-trimethoxy-N-(2-pyrrolidin-1-ylethyl)benzamide;hydrochloride
3,4,5-trimethoxy-N-(2-pyrrolidin-1-ylethyl)benzamide;hydrochloride (PubChem CID 2947321) has the molecular formula C16H25ClN2O4
and a molecular weight of 344.84 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-(2-pyrrolidin-1-ylethyl)benzamide;hydrochloride.
Molecular Properties
| Compound Name | 3,4,5-trimethoxy-N-(2-pyrrolidin-1-ylethyl)benzamide;hydrochloride |
| PubChem CID | 2947321 |
| Molecular Formula | C16H25ClN2O4 |
| Molecular Weight | 344.84 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | 3,4,5-trimethoxy-N-(2-pyrrolidin-1-ylethyl)benzamide;hydrochloride |
| SMILES | COc1cc(C(=O)NCCN2CCCC2)cc(OC)c1OC.Cl |
| InChI | InChI=1S/C16H24N2O4.ClH/c1-20-13-10-12(11-14(21-2)15(13)22-3)16(19)17-6-9-18-7-4-5-8-18;/h10-11H,4-9H2,1-3H3,(H,17,19);1H |
| InChIKey | VWXSHDFWAUAHOK-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.84 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3,4,5-trimethoxy-N-(2-pyrrolidin-1-ylethyl)benzamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4,5-trimethoxy-N-(2-pyrrolidin-1-ylethyl)benzamide;hydrochloride?
The IUPAC name of 3,4,5-trimethoxy-N-(2-pyrrolidin-1-ylethyl)benzamide;hydrochloride (CID 2947321) is 3,4,5-trimethoxy-N-(2-pyrrolidin-1-ylethyl)benzamide;hydrochloride.
What is the SMILES notation for 3,4,5-trimethoxy-N-(2-pyrrolidin-1-ylethyl)benzamide;hydrochloride?
The canonical SMILES for 3,4,5-trimethoxy-N-(2-pyrrolidin-1-ylethyl)benzamide;hydrochloride is COc1cc(C(=O)NCCN2CCCC2)cc(OC)c1OC.Cl.
What is the InChIKey of 3,4,5-trimethoxy-N-(2-pyrrolidin-1-ylethyl)benzamide;hydrochloride?
The InChIKey is VWXSHDFWAUAHOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24N2O4.ClH/c1-20-13-10-12(11-14(21-2)15(13)22-3)16(19)17-6-9-18-7-4-5-8-18;/h10-11H,4-9H2,1-3H3,(H,17,19);1H.
What are the key properties of 3,4,5-trimethoxy-N-(2-pyrrolidin-1-ylethyl)benzamide;hydrochloride?
3,4,5-trimethoxy-N-(2-pyrrolidin-1-ylethyl)benzamide;hydrochloride has a molecular weight of 344.84 g/mol, XLogP of 1.96, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4,5-trimethoxy-N-(2-pyrrolidin-1-ylethyl)benzamide;hydrochloride is sourced from PubChem (CID 2947321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).