C17H18N4O2 — CID 29473324
3-[(4-pyrazol-1-ylphenyl)methyl]-1,3-diazaspiro[4.4]nonane-2,4-dione (PubChem CID 29473324) has the molecular formula C17H18N4O2 and a molecular weight of 310.36 g/mol. Its IUPAC name is 3-[(4-pyrazol-1-ylphenyl)methyl]-1,3-diazaspiro[4.4]nonane-2,4-dione.
| Compound Name | 3-[(4-pyrazol-1-ylphenyl)methyl]-1,3-diazaspiro[4.4]nonane-2,4-dione |
|---|---|
| PubChem CID | 29473324 |
| Molecular Formula | C17H18N4O2 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 3-[(4-pyrazol-1-ylphenyl)methyl]-1,3-diazaspiro[4.4]nonane-2,4-dione |
| SMILES | O=C1NC2(CCCC2)C(=O)N1Cc1ccc(-n2cccn2)cc1 |
| InChI | InChI=1S/C17H18N4O2/c22-15-17(8-1-2-9-17)19-16(23)20(15)12-13-4-6-14(7-5-13)21-11-3-10-18-21/h3-7,10-11H,1-2,8-9,12H2,(H,19,23) |
| InChIKey | HZIWLVSJFORTHP-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|