C27H26FN3O6 — CID 2947373
1-(2-fluorophenyl)-5-(2-pyridin-2-ylethyl)-5-[(3,4,5-trimethoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione (PubChem CID 2947373) has the molecular formula C27H26FN3O6 and a molecular weight of 507.52 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-5-(2-pyridin-2-ylethyl)-5-[(3,4,5-trimethoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-(2-fluorophenyl)-5-(2-pyridin-2-ylethyl)-5-[(3,4,5-trimethoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 2947373 |
| Molecular Formula | C27H26FN3O6 |
| Molecular Weight | 507.52 g/mol |
| Exact Mass | 507.18 |
| IUPAC Name | 1-(2-fluorophenyl)-5-(2-pyridin-2-ylethyl)-5-[(3,4,5-trimethoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione |
| SMILES | COc1cc(CC2(CCc3ccccn3)C(=O)NC(=O)N(c3ccccc3F)C2=O)cc(OC)c1OC |
| InChI | InChI=1S/C27H26FN3O6/c1-35-21-14-17(15-22(36-2)23(21)37-3)16-27(12-11-18-8-6-7-13-29-18)24(32)30-26(34)31(25(27)33)20-10-5-4-9-19(20)28/h4-10,13-15H,11-12,16H2,1-3H3,(H,30,32,34) |
| InChIKey | HNHMGAGWQHPYDP-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 107.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.52 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|