C19H30N2O3S — CID 2947893
N-[4-(butan-2-ylsulfamoyl)phenyl]-3-cyclohexylpropanamide (PubChem CID 2947893) has the molecular formula C19H30N2O3S and a molecular weight of 366.53 g/mol. Its IUPAC name is N-[4-(butan-2-ylsulfamoyl)phenyl]-3-cyclohexylpropanamide.
| Compound Name | N-[4-(butan-2-ylsulfamoyl)phenyl]-3-cyclohexylpropanamide |
|---|---|
| PubChem CID | 2947893 |
| Molecular Formula | C19H30N2O3S |
| Molecular Weight | 366.53 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | N-[4-(butan-2-ylsulfamoyl)phenyl]-3-cyclohexylpropanamide |
| SMILES | CCC(C)NS(=O)(=O)c1ccc(NC(=O)CCC2CCCCC2)cc1 |
| InChI | InChI=1S/C19H30N2O3S/c1-3-15(2)21-25(23,24)18-12-10-17(11-13-18)20-19(22)14-9-16-7-5-4-6-8-16/h10-13,15-16,21H,3-9,14H2,1-2H3,(H,20,22) |
| InChIKey | IJAHCHPJWKPOMN-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.53 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |