About N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-N-(4-methylphenyl)-2-oxochromene-3-carboxamide
N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-N-(4-methylphenyl)-2-oxochromene-3-carboxamide (PubChem CID 2947988) has the molecular formula C21H17NO5S
and a molecular weight of 395.44 g/mol. Its IUPAC name is N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-N-(4-methylphenyl)-2-oxochromene-3-carboxamide.
Molecular Properties
| Compound Name | N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-N-(4-methylphenyl)-2-oxochromene-3-carboxamide |
| PubChem CID | 2947988 |
| Molecular Formula | C21H17NO5S |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-N-(4-methylphenyl)-2-oxochromene-3-carboxamide |
| SMILES | Cc1ccc(N(C(=O)c2cc3ccccc3oc2=O)C2C=CS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C21H17NO5S/c1-14-6-8-16(9-7-14)22(17-10-11-28(25,26)13-17)20(23)18-12-15-4-2-3-5-19(15)27-21(18)24/h2-12,17H,13H2,1H3 |
| InChIKey | GYGDRMBZKXPQPS-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 84.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-N-(4-methylphenyl)-2-oxochromene-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-N-(4-methylphenyl)-2-oxochromene-3-carboxamide?
The IUPAC name of N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-N-(4-methylphenyl)-2-oxochromene-3-carboxamide (CID 2947988) is N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-N-(4-methylphenyl)-2-oxochromene-3-carboxamide.
What is the SMILES notation for N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-N-(4-methylphenyl)-2-oxochromene-3-carboxamide?
The canonical SMILES for N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-N-(4-methylphenyl)-2-oxochromene-3-carboxamide is Cc1ccc(N(C(=O)c2cc3ccccc3oc2=O)C2C=CS(=O)(=O)C2)cc1.
What is the InChIKey of N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-N-(4-methylphenyl)-2-oxochromene-3-carboxamide?
The InChIKey is GYGDRMBZKXPQPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17NO5S/c1-14-6-8-16(9-7-14)22(17-10-11-28(25,26)13-17)20(23)18-12-15-4-2-3-5-19(15)27-21(18)24/h2-12,17H,13H2,1H3.
What are the key properties of N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-N-(4-methylphenyl)-2-oxochromene-3-carboxamide?
N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-N-(4-methylphenyl)-2-oxochromene-3-carboxamide has a molecular weight of 395.44 g/mol, XLogP of 3.06, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-N-(4-methylphenyl)-2-oxochromene-3-carboxamide is sourced from PubChem (CID 2947988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).