About N-butan-2-yl-2-[[2-[(2,6-dichlorophenyl)methylsulfanyl]acetyl]amino]benzamide
N-butan-2-yl-2-[[2-[(2,6-dichlorophenyl)methylsulfanyl]acetyl]amino]benzamide (PubChem CID 2948356) has the molecular formula C20H22Cl2N2O2S
and a molecular weight of 425.38 g/mol. Its IUPAC name is N-butan-2-yl-2-[[2-[(2,6-dichlorophenyl)methylsulfanyl]acetyl]amino]benzamide.
Molecular Properties
| Compound Name | N-butan-2-yl-2-[[2-[(2,6-dichlorophenyl)methylsulfanyl]acetyl]amino]benzamide |
| PubChem CID | 2948356 |
| Molecular Formula | C20H22Cl2N2O2S |
| Molecular Weight | 425.38 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | N-butan-2-yl-2-[[2-[(2,6-dichlorophenyl)methylsulfanyl]acetyl]amino]benzamide |
| SMILES | CCC(C)NC(=O)c1ccccc1NC(=O)CSCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C20H22Cl2N2O2S/c1-3-13(2)23-20(26)14-7-4-5-10-18(14)24-19(25)12-27-11-15-16(21)8-6-9-17(15)22/h4-10,13H,3,11-12H2,1-2H3,(H,23,26)(H,24,25) |
| InChIKey | CTUJQFYIHWKELB-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 425.38 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-butan-2-yl-2-[[2-[(2,6-dichlorophenyl)methylsulfanyl]acetyl]amino]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butan-2-yl-2-[[2-[(2,6-dichlorophenyl)methylsulfanyl]acetyl]amino]benzamide?
The IUPAC name of N-butan-2-yl-2-[[2-[(2,6-dichlorophenyl)methylsulfanyl]acetyl]amino]benzamide (CID 2948356) is N-butan-2-yl-2-[[2-[(2,6-dichlorophenyl)methylsulfanyl]acetyl]amino]benzamide.
What is the SMILES notation for N-butan-2-yl-2-[[2-[(2,6-dichlorophenyl)methylsulfanyl]acetyl]amino]benzamide?
The canonical SMILES for N-butan-2-yl-2-[[2-[(2,6-dichlorophenyl)methylsulfanyl]acetyl]amino]benzamide is CCC(C)NC(=O)c1ccccc1NC(=O)CSCc1c(Cl)cccc1Cl.
What is the InChIKey of N-butan-2-yl-2-[[2-[(2,6-dichlorophenyl)methylsulfanyl]acetyl]amino]benzamide?
The InChIKey is CTUJQFYIHWKELB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22Cl2N2O2S/c1-3-13(2)23-20(26)14-7-4-5-10-18(14)24-19(25)12-27-11-15-16(21)8-6-9-17(15)22/h4-10,13H,3,11-12H2,1-2H3,(H,23,26)(H,24,25).
What are the key properties of N-butan-2-yl-2-[[2-[(2,6-dichlorophenyl)methylsulfanyl]acetyl]amino]benzamide?
N-butan-2-yl-2-[[2-[(2,6-dichlorophenyl)methylsulfanyl]acetyl]amino]benzamide has a molecular weight of 425.38 g/mol, XLogP of 5.39, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-butan-2-yl-2-[[2-[(2,6-dichlorophenyl)methylsulfanyl]acetyl]amino]benzamide is sourced from PubChem (CID 2948356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).