C18H21N3O5S — CID 2948916
N-(2,3-dimethylphenyl)-2-(2-methyl-N-methylsulfonyl-5-nitroanilino)acetamide (PubChem CID 2948916) has the molecular formula C18H21N3O5S and a molecular weight of 391.45 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-2-(2-methyl-N-methylsulfonyl-5-nitroanilino)acetamide.
| Compound Name | N-(2,3-dimethylphenyl)-2-(2-methyl-N-methylsulfonyl-5-nitroanilino)acetamide |
|---|---|
| PubChem CID | 2948916 |
| Molecular Formula | C18H21N3O5S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | N-(2,3-dimethylphenyl)-2-(2-methyl-N-methylsulfonyl-5-nitroanilino)acetamide |
| SMILES | Cc1ccc([N+](=O)[O-])cc1N(CC(=O)Nc1cccc(C)c1C)S(C)(=O)=O |
| InChI | InChI=1S/C18H21N3O5S/c1-12-6-5-7-16(14(12)3)19-18(22)11-20(27(4,25)26)17-10-15(21(23)24)9-8-13(17)2/h5-10H,11H2,1-4H3,(H,19,22) |
| InChIKey | UGNLKMGADOOLLV-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|