About 5-chloro-3,3-bis(1H-indol-3-yl)-1H-indol-2-one
5-chloro-3,3-bis(1H-indol-3-yl)-1H-indol-2-one (PubChem CID 2948971) has the molecular formula C24H16ClN3O
and a molecular weight of 397.87 g/mol. Its IUPAC name is 5-chloro-3,3-bis(1H-indol-3-yl)-1H-indol-2-one.
Molecular Properties
| Compound Name | 5-chloro-3,3-bis(1H-indol-3-yl)-1H-indol-2-one |
| PubChem CID | 2948971 |
| Molecular Formula | C24H16ClN3O |
| Molecular Weight | 397.87 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | 5-chloro-3,3-bis(1H-indol-3-yl)-1H-indol-2-one |
| SMILES | O=C1Nc2ccc(Cl)cc2C1(c1c[nH]c2ccccc12)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C24H16ClN3O/c25-14-9-10-22-17(11-14)24(23(29)28-22,18-12-26-20-7-3-1-5-15(18)20)19-13-27-21-8-4-2-6-16(19)21/h1-13,26-27H,(H,28,29) |
| InChIKey | KQTQQJVFFASAJD-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 60.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 397.87 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-chloro-3,3-bis(1H-indol-3-yl)-1H-indol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-3,3-bis(1H-indol-3-yl)-1H-indol-2-one?
The IUPAC name of 5-chloro-3,3-bis(1H-indol-3-yl)-1H-indol-2-one (CID 2948971) is 5-chloro-3,3-bis(1H-indol-3-yl)-1H-indol-2-one.
What is the SMILES notation for 5-chloro-3,3-bis(1H-indol-3-yl)-1H-indol-2-one?
The canonical SMILES for 5-chloro-3,3-bis(1H-indol-3-yl)-1H-indol-2-one is O=C1Nc2ccc(Cl)cc2C1(c1c[nH]c2ccccc12)c1c[nH]c2ccccc12.
What is the InChIKey of 5-chloro-3,3-bis(1H-indol-3-yl)-1H-indol-2-one?
The InChIKey is KQTQQJVFFASAJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H16ClN3O/c25-14-9-10-22-17(11-14)24(23(29)28-22,18-12-26-20-7-3-1-5-15(18)20)19-13-27-21-8-4-2-6-16(19)21/h1-13,26-27H,(H,28,29).
What are the key properties of 5-chloro-3,3-bis(1H-indol-3-yl)-1H-indol-2-one?
5-chloro-3,3-bis(1H-indol-3-yl)-1H-indol-2-one has a molecular weight of 397.87 g/mol, XLogP of 5.59, 2 rotatable bonds, 3 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-3,3-bis(1H-indol-3-yl)-1H-indol-2-one is sourced from PubChem (CID 2948971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).