C25H34N2O7S — CID 2949081
1-[2-(4-methylphenyl)sulfanylethyl]-4-[(2,3,4-trimethoxyphenyl)methyl]piperazine;oxalic acid (PubChem CID 2949081) has the molecular formula C25H34N2O7S and a molecular weight of 506.62 g/mol. Its IUPAC name is 1-[2-(4-methylphenyl)sulfanylethyl]-4-[(2,3,4-trimethoxyphenyl)methyl]piperazine;oxalic acid.
| Compound Name | 1-[2-(4-methylphenyl)sulfanylethyl]-4-[(2,3,4-trimethoxyphenyl)methyl]piperazine;oxalic acid |
|---|---|
| PubChem CID | 2949081 |
| Molecular Formula | C25H34N2O7S |
| Molecular Weight | 506.62 g/mol |
| Exact Mass | 506.21 |
| IUPAC Name | 1-[2-(4-methylphenyl)sulfanylethyl]-4-[(2,3,4-trimethoxyphenyl)methyl]piperazine;oxalic acid |
| SMILES | COc1ccc(CN2CCN(CCSc3ccc(C)cc3)CC2)c(OC)c1OC.O=C(O)C(=O)O |
| InChI | InChI=1S/C23H32N2O3S.C2H2O4/c1-18-5-8-20(9-6-18)29-16-15-24-11-13-25(14-12-24)17-19-7-10-21(26-2)23(28-4)22(19)27-3;3-1(4)2(5)6/h5-10H,11-17H2,1-4H3;(H,3,4)(H,5,6) |
| InChIKey | AVGVZLBSYSKFBI-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 108.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.62 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|