C16H12BrNO2S — CID 2949163
5-bromo-1,7-dimethyl-3-(2-oxo-2-thiophen-2-ylethylidene)indol-2-one (PubChem CID 2949163) has the molecular formula C16H12BrNO2S and a molecular weight of 362.25 g/mol. Its IUPAC name is 5-bromo-1,7-dimethyl-3-(2-oxo-2-thiophen-2-ylethylidene)indol-2-one.
| Compound Name | 5-bromo-1,7-dimethyl-3-(2-oxo-2-thiophen-2-ylethylidene)indol-2-one |
|---|---|
| PubChem CID | 2949163 |
| Molecular Formula | C16H12BrNO2S |
| Molecular Weight | 362.25 g/mol |
| Exact Mass | 360.98 |
| IUPAC Name | 5-bromo-1,7-dimethyl-3-(2-oxo-2-thiophen-2-ylethylidene)indol-2-one |
| SMILES | Cc1cc(Br)cc2c1N(C)C(=O)C2=CC(=O)c1cccs1 |
| InChI | InChI=1S/C16H12BrNO2S/c1-9-6-10(17)7-11-12(16(20)18(2)15(9)11)8-13(19)14-4-3-5-21-14/h3-8H,1-2H3 |
| InChIKey | UYTWLHVVZDJVDJ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.25 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|