C19H22BrNO5 — CID 2949268
N-[2-(1-bromonaphthalen-2-yl)oxyethyl]cyclopentanamine;oxalic acid (PubChem CID 2949268) has the molecular formula C19H22BrNO5 and a molecular weight of 424.29 g/mol. Its IUPAC name is N-[2-(1-bromonaphthalen-2-yl)oxyethyl]cyclopentanamine;oxalic acid.
| Compound Name | N-[2-(1-bromonaphthalen-2-yl)oxyethyl]cyclopentanamine;oxalic acid |
|---|---|
| PubChem CID | 2949268 |
| Molecular Formula | C19H22BrNO5 |
| Molecular Weight | 424.29 g/mol |
| Exact Mass | 423.07 |
| IUPAC Name | N-[2-(1-bromonaphthalen-2-yl)oxyethyl]cyclopentanamine;oxalic acid |
| SMILES | Brc1c(OCCNC2CCCC2)ccc2ccccc12.O=C(O)C(=O)O |
| InChI | InChI=1S/C17H20BrNO.C2H2O4/c18-17-15-8-4-1-5-13(15)9-10-16(17)20-12-11-19-14-6-2-3-7-14;3-1(4)2(5)6/h1,4-5,8-10,14,19H,2-3,6-7,11-12H2;(H,3,4)(H,5,6) |
| InChIKey | HPPNQOFKZOSMSO-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.29 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|