C20H23N5O2S — CID 29493828
N-[4-(4-methylpiperazin-1-yl)phenyl]-3-(4-oxothieno[2,3-d]pyrimidin-3-yl)propanamide (PubChem CID 29493828) has the molecular formula C20H23N5O2S and a molecular weight of 397.50 g/mol. Its IUPAC name is N-[4-(4-methylpiperazin-1-yl)phenyl]-3-(4-oxothieno[2,3-d]pyrimidin-3-yl)propanamide.
| Compound Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-3-(4-oxothieno[2,3-d]pyrimidin-3-yl)propanamide |
|---|---|
| PubChem CID | 29493828 |
| Molecular Formula | C20H23N5O2S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-3-(4-oxothieno[2,3-d]pyrimidin-3-yl)propanamide |
| SMILES | CN1CCN(c2ccc(NC(=O)CCn3cnc4sccc4c3=O)cc2)CC1 |
| InChI | InChI=1S/C20H23N5O2S/c1-23-9-11-24(12-10-23)16-4-2-15(3-5-16)22-18(26)6-8-25-14-21-19-17(20(25)27)7-13-28-19/h2-5,7,13-14H,6,8-12H2,1H3,(H,22,26) |
| InChIKey | UVHVXPAKQXTEKD-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|