C20H15Cl2NO3 — CID 2949472
[2,4-dichloro-6-[2-(8-methoxyquinolin-2-yl)ethenyl]phenyl] acetate (PubChem CID 2949472) has the molecular formula C20H15Cl2NO3 and a molecular weight of 388.25 g/mol. Its IUPAC name is [2,4-dichloro-6-[2-(8-methoxyquinolin-2-yl)ethenyl]phenyl] acetate.
| Compound Name | [2,4-dichloro-6-[2-(8-methoxyquinolin-2-yl)ethenyl]phenyl] acetate |
|---|---|
| PubChem CID | 2949472 |
| Molecular Formula | C20H15Cl2NO3 |
| Molecular Weight | 388.25 g/mol |
| Exact Mass | 387.04 |
| IUPAC Name | [2,4-dichloro-6-[2-(8-methoxyquinolin-2-yl)ethenyl]phenyl] acetate |
| SMILES | COc1cccc2ccc(C=Cc3cc(Cl)cc(Cl)c3OC(C)=O)nc12 |
| InChI | InChI=1S/C20H15Cl2NO3/c1-12(24)26-20-14(10-15(21)11-17(20)22)7-9-16-8-6-13-4-3-5-18(25-2)19(13)23-16/h3-11H,1-2H3 |
| InChIKey | DSSPSOSHBOKJDE-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.25 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|