About 2-[[2-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylamino]ethanol;hydrochloride
2-[[2-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylamino]ethanol;hydrochloride (PubChem CID 2949795) has the molecular formula C18H22Cl3NO3
and a molecular weight of 406.74 g/mol. Its IUPAC name is 2-[[2-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylamino]ethanol;hydrochloride.
Molecular Properties
| Compound Name | 2-[[2-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylamino]ethanol;hydrochloride |
| PubChem CID | 2949795 |
| Molecular Formula | C18H22Cl3NO3 |
| Molecular Weight | 406.74 g/mol |
| Exact Mass | 405.07 |
| IUPAC Name | 2-[[2-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylamino]ethanol;hydrochloride |
| SMILES | CCOc1cccc(CNCCO)c1OCc1ccc(Cl)cc1Cl.Cl |
| InChI | InChI=1S/C18H21Cl2NO3.ClH/c1-2-23-17-5-3-4-13(11-21-8-9-22)18(17)24-12-14-6-7-15(19)10-16(14)20;/h3-7,10,21-22H,2,8-9,11-12H2,1H3;1H |
| InChIKey | SFDMHSBRCJJZQW-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.74 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[[2-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylamino]ethanol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylamino]ethanol;hydrochloride?
The IUPAC name of 2-[[2-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylamino]ethanol;hydrochloride (CID 2949795) is 2-[[2-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylamino]ethanol;hydrochloride.
What is the SMILES notation for 2-[[2-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylamino]ethanol;hydrochloride?
The canonical SMILES for 2-[[2-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylamino]ethanol;hydrochloride is CCOc1cccc(CNCCO)c1OCc1ccc(Cl)cc1Cl.Cl.
What is the InChIKey of 2-[[2-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylamino]ethanol;hydrochloride?
The InChIKey is SFDMHSBRCJJZQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21Cl2NO3.ClH/c1-2-23-17-5-3-4-13(11-21-8-9-22)18(17)24-12-14-6-7-15(19)10-16(14)20;/h3-7,10,21-22H,2,8-9,11-12H2,1H3;1H.
What are the key properties of 2-[[2-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylamino]ethanol;hydrochloride?
2-[[2-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylamino]ethanol;hydrochloride has a molecular weight of 406.74 g/mol, XLogP of 4.47, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylamino]ethanol;hydrochloride is sourced from PubChem (CID 2949795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).