C24H27FN4O4S — CID 29498799
N-[5-(diethylsulfamoyl)-2-hydroxyphenyl]-1-(4-fluorophenyl)-4,5,6,7-tetrahydroindazole-3-carboxamide (PubChem CID 29498799) has the molecular formula C24H27FN4O4S and a molecular weight of 486.57 g/mol. Its IUPAC name is N-[5-(diethylsulfamoyl)-2-hydroxyphenyl]-1-(4-fluorophenyl)-4,5,6,7-tetrahydroindazole-3-carboxamide.
| Compound Name | N-[5-(diethylsulfamoyl)-2-hydroxyphenyl]-1-(4-fluorophenyl)-4,5,6,7-tetrahydroindazole-3-carboxamide |
|---|---|
| PubChem CID | 29498799 |
| Molecular Formula | C24H27FN4O4S |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | N-[5-(diethylsulfamoyl)-2-hydroxyphenyl]-1-(4-fluorophenyl)-4,5,6,7-tetrahydroindazole-3-carboxamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(O)c(NC(=O)c2nn(-c3ccc(F)cc3)c3c2CCCC3)c1 |
| InChI | InChI=1S/C24H27FN4O4S/c1-3-28(4-2)34(32,33)18-13-14-22(30)20(15-18)26-24(31)23-19-7-5-6-8-21(19)29(27-23)17-11-9-16(25)10-12-17/h9-15,30H,3-8H2,1-2H3,(H,26,31) |
| InChIKey | QUHDRBDAUBJDFU-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|