C12H16N4O2 — CID 29503
6,7-dimethoxy-2-N,2-N-dimethylquinazoline-2,4-diamine (PubChem CID 29503) has the molecular formula C12H16N4O2 and a molecular weight of 248.29 g/mol. Its IUPAC name is 6,7-dimethoxy-2-N,2-N-dimethylquinazoline-2,4-diamine.
| Compound Name | 6,7-dimethoxy-2-N,2-N-dimethylquinazoline-2,4-diamine |
|---|---|
| PubChem CID | 29503 |
| Molecular Formula | C12H16N4O2 |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 6,7-dimethoxy-2-N,2-N-dimethylquinazoline-2,4-diamine |
| SMILES | COc1cc2nc(N(C)C)nc(N)c2cc1OC |
| InChI | InChI=1S/C12H16N4O2/c1-16(2)12-14-8-6-10(18-4)9(17-3)5-7(8)11(13)15-12/h5-6H,1-4H3,(H2,13,14,15) |
| InChIKey | JALPLGVFZRCLGE-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 73.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |