C15H21NO4 — CID 2951065
4-methyl-2-(5-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)pentanoic acid (PubChem CID 2951065) has the molecular formula C15H21NO4 and a molecular weight of 279.34 g/mol. Its IUPAC name is 4-methyl-2-(5-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)pentanoic acid.
| Compound Name | 4-methyl-2-(5-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)pentanoic acid |
|---|---|
| PubChem CID | 2951065 |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 4-methyl-2-(5-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)pentanoic acid |
| SMILES | CC1=CCC2C(=O)N(C(CC(C)C)C(=O)O)C(=O)C2C1 |
| InChI | InChI=1S/C15H21NO4/c1-8(2)6-12(15(19)20)16-13(17)10-5-4-9(3)7-11(10)14(16)18/h4,8,10-12H,5-7H2,1-3H3,(H,19,20) |
| InChIKey | MZXRNJVEPRVAOA-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|