About 4-benzoyloxybutyl benzoate
4-benzoyloxybutyl benzoate (PubChem CID 29511) has the molecular formula C18H18O4
and a molecular weight of 298.34 g/mol. Its IUPAC name is 4-benzoyloxybutyl benzoate.
Molecular Properties
| Compound Name | 4-benzoyloxybutyl benzoate |
| PubChem CID | 29511 |
| Molecular Formula | C18H18O4 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 4-benzoyloxybutyl benzoate |
| SMILES | O=C(OCCCCOC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H18O4/c19-17(15-9-3-1-4-10-15)21-13-7-8-14-22-18(20)16-11-5-2-6-12-16/h1-6,9-12H,7-8,13-14H2 |
| InChIKey | YHOWYTOWCBNTHB-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-benzoyloxybutyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzoyloxybutyl benzoate?
The IUPAC name of 4-benzoyloxybutyl benzoate (CID 29511) is 4-benzoyloxybutyl benzoate.
What is the SMILES notation for 4-benzoyloxybutyl benzoate?
The canonical SMILES for 4-benzoyloxybutyl benzoate is O=C(OCCCCOC(=O)c1ccccc1)c1ccccc1.
What is the InChIKey of 4-benzoyloxybutyl benzoate?
The InChIKey is YHOWYTOWCBNTHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18O4/c19-17(15-9-3-1-4-10-15)21-13-7-8-14-22-18(20)16-11-5-2-6-12-16/h1-6,9-12H,7-8,13-14H2.
What are the key properties of 4-benzoyloxybutyl benzoate?
4-benzoyloxybutyl benzoate has a molecular weight of 298.34 g/mol, XLogP of 3.48, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzoyloxybutyl benzoate is sourced from PubChem (CID 29511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).