About N,3-diphenyl-3,4-dihydropyrazole-2-carboxamide
N,3-diphenyl-3,4-dihydropyrazole-2-carboxamide (PubChem CID 2951131) has the molecular formula C16H15N3O
and a molecular weight of 265.32 g/mol. Its IUPAC name is N,3-diphenyl-3,4-dihydropyrazole-2-carboxamide.
Molecular Properties
| Compound Name | N,3-diphenyl-3,4-dihydropyrazole-2-carboxamide |
| PubChem CID | 2951131 |
| Molecular Formula | C16H15N3O |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | N,3-diphenyl-3,4-dihydropyrazole-2-carboxamide |
| SMILES | O=C(Nc1ccccc1)N1N=CCC1c1ccccc1 |
| InChI | InChI=1S/C16H15N3O/c20-16(18-14-9-5-2-6-10-14)19-15(11-12-17-19)13-7-3-1-4-8-13/h1-10,12,15H,11H2,(H,18,20) |
| InChIKey | OPPQJMOJMXRLBQ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,3-diphenyl-3,4-dihydropyrazole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,3-diphenyl-3,4-dihydropyrazole-2-carboxamide?
The IUPAC name of N,3-diphenyl-3,4-dihydropyrazole-2-carboxamide (CID 2951131) is N,3-diphenyl-3,4-dihydropyrazole-2-carboxamide.
What is the SMILES notation for N,3-diphenyl-3,4-dihydropyrazole-2-carboxamide?
The canonical SMILES for N,3-diphenyl-3,4-dihydropyrazole-2-carboxamide is O=C(Nc1ccccc1)N1N=CCC1c1ccccc1.
What is the InChIKey of N,3-diphenyl-3,4-dihydropyrazole-2-carboxamide?
The InChIKey is OPPQJMOJMXRLBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N3O/c20-16(18-14-9-5-2-6-10-14)19-15(11-12-17-19)13-7-3-1-4-8-13/h1-10,12,15H,11H2,(H,18,20).
What are the key properties of N,3-diphenyl-3,4-dihydropyrazole-2-carboxamide?
N,3-diphenyl-3,4-dihydropyrazole-2-carboxamide has a molecular weight of 265.32 g/mol, XLogP of 3.65, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,3-diphenyl-3,4-dihydropyrazole-2-carboxamide is sourced from PubChem (CID 2951131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).