C21H23FN2O3S — CID 2951263
2-[N-(benzenesulfonyl)-2-fluoroanilino]-N-(2-bicyclo[2.2.1]heptanyl)acetamide (PubChem CID 2951263) has the molecular formula C21H23FN2O3S and a molecular weight of 402.49 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-2-fluoroanilino]-N-(2-bicyclo[2.2.1]heptanyl)acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-2-fluoroanilino]-N-(2-bicyclo[2.2.1]heptanyl)acetamide |
|---|---|
| PubChem CID | 2951263 |
| Molecular Formula | C21H23FN2O3S |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-2-fluoroanilino]-N-(2-bicyclo[2.2.1]heptanyl)acetamide |
| SMILES | O=C(CN(c1ccccc1F)S(=O)(=O)c1ccccc1)NC1CC2CCC1C2 |
| InChI | InChI=1S/C21H23FN2O3S/c22-18-8-4-5-9-20(18)24(28(26,27)17-6-2-1-3-7-17)14-21(25)23-19-13-15-10-11-16(19)12-15/h1-9,15-16,19H,10-14H2,(H,23,25) |
| InChIKey | WCIOYAJGSKNPRX-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |