C17H17FN2O2 — CID 2951597
N-[(4-fluorophenyl)methyl]-N'-(1-phenylethyl)oxamide (PubChem CID 2951597) has the molecular formula C17H17FN2O2 and a molecular weight of 300.33 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-N'-(1-phenylethyl)oxamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-N'-(1-phenylethyl)oxamide |
|---|---|
| PubChem CID | 2951597 |
| Molecular Formula | C17H17FN2O2 |
| Molecular Weight | 300.33 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-N'-(1-phenylethyl)oxamide |
| SMILES | CC(NC(=O)C(=O)NCc1ccc(F)cc1)c1ccccc1 |
| InChI | InChI=1S/C17H17FN2O2/c1-12(14-5-3-2-4-6-14)20-17(22)16(21)19-11-13-7-9-15(18)10-8-13/h2-10,12H,11H2,1H3,(H,19,21)(H,20,22) |
| InChIKey | OUWAKCDLFDSZPY-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.33 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|