C33H29N5O5 — CID 2951771
2-[5-[4-(4-methoxybenzoyl)piperazin-1-yl]-2-nitrophenyl]-4-(4-methylphenyl)phthalazin-1-one (PubChem CID 2951771) has the molecular formula C33H29N5O5 and a molecular weight of 575.63 g/mol. Its IUPAC name is 2-[5-[4-(4-methoxybenzoyl)piperazin-1-yl]-2-nitrophenyl]-4-(4-methylphenyl)phthalazin-1-one.
| Compound Name | 2-[5-[4-(4-methoxybenzoyl)piperazin-1-yl]-2-nitrophenyl]-4-(4-methylphenyl)phthalazin-1-one |
|---|---|
| PubChem CID | 2951771 |
| Molecular Formula | C33H29N5O5 |
| Molecular Weight | 575.63 g/mol |
| Exact Mass | 575.22 |
| IUPAC Name | 2-[5-[4-(4-methoxybenzoyl)piperazin-1-yl]-2-nitrophenyl]-4-(4-methylphenyl)phthalazin-1-one |
| SMILES | COc1ccc(C(=O)N2CCN(c3ccc([N+](=O)[O-])c(-n4nc(-c5ccc(C)cc5)c5ccccc5c4=O)c3)CC2)cc1 |
| InChI | InChI=1S/C33H29N5O5/c1-22-7-9-23(10-8-22)31-27-5-3-4-6-28(27)33(40)37(34-31)30-21-25(13-16-29(30)38(41)42)35-17-19-36(20-18-35)32(39)24-11-14-26(43-2)15-12-24/h3-16,21H,17-20H2,1-2H3 |
| InChIKey | RQLWYVWTTJQDGA-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 110.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.63 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|