C21H20N2O3S — CID 2951815
3-[(3,5-dimethylphenyl)methyl]-1-(6-methoxy-1,3-benzothiazol-2-yl)pyrrolidine-2,5-dione (PubChem CID 2951815) has the molecular formula C21H20N2O3S and a molecular weight of 380.47 g/mol. Its IUPAC name is 3-[(3,5-dimethylphenyl)methyl]-1-(6-methoxy-1,3-benzothiazol-2-yl)pyrrolidine-2,5-dione.
| Compound Name | 3-[(3,5-dimethylphenyl)methyl]-1-(6-methoxy-1,3-benzothiazol-2-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 2951815 |
| Molecular Formula | C21H20N2O3S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | 3-[(3,5-dimethylphenyl)methyl]-1-(6-methoxy-1,3-benzothiazol-2-yl)pyrrolidine-2,5-dione |
| SMILES | COc1ccc2nc(N3C(=O)CC(Cc4cc(C)cc(C)c4)C3=O)sc2c1 |
| InChI | InChI=1S/C21H20N2O3S/c1-12-6-13(2)8-14(7-12)9-15-10-19(24)23(20(15)25)21-22-17-5-4-16(26-3)11-18(17)27-21/h4-8,11,15H,9-10H2,1-3H3 |
| InChIKey | HWRYFEIMQUJVFP-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|