C20H21N5O2 — CID 2951841
2-(5-methyl-7-phenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione (PubChem CID 2951841) has the molecular formula C20H21N5O2 and a molecular weight of 363.42 g/mol. Its IUPAC name is 2-(5-methyl-7-phenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione.
| Compound Name | 2-(5-methyl-7-phenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 2951841 |
| Molecular Formula | C20H21N5O2 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | 2-(5-methyl-7-phenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
| SMILES | CC1=CC(c2ccccc2)n2nc(N3C(=O)C4CCCCC4C3=O)nc2N1 |
| InChI | InChI=1S/C20H21N5O2/c1-12-11-16(13-7-3-2-4-8-13)25-19(21-12)22-20(23-25)24-17(26)14-9-5-6-10-15(14)18(24)27/h2-4,7-8,11,14-16H,5-6,9-10H2,1H3,(H,21,22,23) |
| InChIKey | QYOZLEKFBWXXNT-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|